C22H21F3O2 — CID 143875201
4-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-3-fluorophenol (PubChem CID 143875201) has the molecular formula C22H21F3O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-3-fluorophenol.
| Compound Name | 4-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-3-fluorophenol |
|---|---|
| PubChem CID | 143875201 |
| Molecular Formula | C22H21F3O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-3-fluorophenol |
| SMILES | C=C(/C=C/C(=C)C(=C)/C(F)=C(\F)C(=C)OCC)/C=C/c1ccc(O)cc1F |
| InChI | InChI=1S/C22H21F3O2/c1-6-27-17(5)22(25)21(24)16(4)15(3)9-7-14(2)8-10-18-11-12-19(26)13-20(18)23/h7-13,26H,2-6H2,1H3/b9-7-,10-8+,22-21- |
| InChIKey | FAVFQDVIUBDNQI-NUBZSQKQSA-N |
| XLogP | 6.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|