C23H22F4O — CID 143875229
1-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 143875229) has the molecular formula C23H22F4O and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 143875229 |
| Molecular Formula | C23H22F4O |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(1E,4Z,8Z)-10-ethoxy-8,9-difluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=C(/C=C/C(=C)C(=C)/C(F)=C(\F)C(=C)OCC)/C=C/c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C23H22F4O/c1-7-28-18(6)22(26)21(25)17(5)15(3)10-8-14(2)9-12-19-13-11-16(4)20(24)23(19)27/h8-13H,2-3,5-7H2,1,4H3/b10-8-,12-9+,22-21- |
| InChIKey | HILZASIBUVOGFL-YJOLGXLJSA-N |
| XLogP | 7.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|