C22H21F3 — CID 143875025
2,3-difluoro-1-[(1E,4Z,8E)-9-fluoro-10-methyl-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-4-methylbenzene (PubChem CID 143875025) has the molecular formula C22H21F3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2,3-difluoro-1-[(1E,4Z,8E)-9-fluoro-10-methyl-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-4-methylbenzene.
| Compound Name | 2,3-difluoro-1-[(1E,4Z,8E)-9-fluoro-10-methyl-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 143875025 |
| Molecular Formula | C22H21F3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2,3-difluoro-1-[(1E,4Z,8E)-9-fluoro-10-methyl-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-4-methylbenzene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/F)C(=C)C)/C=C/c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C22H21F3/c1-14(2)20(23)13-18(6)16(4)9-7-15(3)8-11-19-12-10-17(5)21(24)22(19)25/h7-13H,1,3-4,6H2,2,5H3/b9-7-,11-8+,20-13+ |
| InChIKey | MDCWHYXHULIXNL-LHQYNRDBSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|