C14H15NO3 — CID 162728388
[4-methyl-3-[(Z)-3-methylidene-4-oxopent-1-enyl]phenyl]carbamic acid (PubChem CID 162728388) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is [4-methyl-3-[(Z)-3-methylidene-4-oxopent-1-enyl]phenyl]carbamic acid.
| Compound Name | [4-methyl-3-[(Z)-3-methylidene-4-oxopent-1-enyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 162728388 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | [4-methyl-3-[(Z)-3-methylidene-4-oxopent-1-enyl]phenyl]carbamic acid |
| SMILES | C=C(/C=C\c1cc(NC(=O)O)ccc1C)C(C)=O |
| InChI | InChI=1S/C14H15NO3/c1-9(11(3)16)4-6-12-8-13(15-14(17)18)7-5-10(12)2/h4-8,15H,1H2,2-3H3,(H,17,18)/b6-4- |
| InChIKey | KOUDTIFQFYRNOH-XQRVVYSFSA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|