C16H19F — CID 143773264
(5Z)-2-fluoro-10-methyl-3,4,7,8-tetramethylideneundeca-1,5,9-triene (PubChem CID 143773264) has the molecular formula C16H19F and a molecular weight of 230.33 g/mol. Its IUPAC name is (5Z)-2-fluoro-10-methyl-3,4,7,8-tetramethylideneundeca-1,5,9-triene.
| Compound Name | (5Z)-2-fluoro-10-methyl-3,4,7,8-tetramethylideneundeca-1,5,9-triene |
|---|---|
| PubChem CID | 143773264 |
| Molecular Formula | C16H19F |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (5Z)-2-fluoro-10-methyl-3,4,7,8-tetramethylideneundeca-1,5,9-triene |
| SMILES | C=C(F)C(=C)C(=C)/C=C/C(=C)C(=C)C=C(C)C |
| InChI | InChI=1S/C16H19F/c1-11(2)10-14(5)12(3)8-9-13(4)15(6)16(7)17/h8-10H,3-7H2,1-2H3/b9-8- |
| InChIKey | WLGDLUDPLPDMSN-HJWRWDBZSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|