C8H9F3 — CID 138600240
(3Z)-2,3,4-trifluoro-6-methylhepta-1,3,5-triene (PubChem CID 138600240) has the molecular formula C8H9F3 and a molecular weight of 162.15 g/mol. Its IUPAC name is (3Z)-2,3,4-trifluoro-6-methylhepta-1,3,5-triene.
| Compound Name | (3Z)-2,3,4-trifluoro-6-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 138600240 |
| Molecular Formula | C8H9F3 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (3Z)-2,3,4-trifluoro-6-methylhepta-1,3,5-triene |
| SMILES | C=C(F)/C(F)=C(/F)C=C(C)C |
| InChI | InChI=1S/C8H9F3/c1-5(2)4-7(10)8(11)6(3)9/h4H,3H2,1-2H3/b8-7- |
| InChIKey | LOIHYKRQWJWSPF-FPLPWBNLSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|