C5H5F3 — CID 18520937
1,1,2-trifluoro-3-methylbuta-1,3-diene (PubChem CID 18520937) has the molecular formula C5H5F3 and a molecular weight of 122.09 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-methylbuta-1,3-diene.
| Compound Name | 1,1,2-trifluoro-3-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 18520937 |
| Molecular Formula | C5H5F3 |
| Molecular Weight | 122.09 g/mol |
| Exact Mass | 122.03 |
| IUPAC Name | 1,1,2-trifluoro-3-methylbuta-1,3-diene |
| SMILES | C=C(C)C(F)=C(F)F |
| InChI | InChI=1S/C5H5F3/c1-3(2)4(6)5(7)8/h1H2,2H3 |
| InChIKey | LEAVKXWGBWVZTN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|