C4H4F3N — CID 58488810
3,4,4-trifluorobut-3-en-2-imine (PubChem CID 58488810) has the molecular formula C4H4F3N and a molecular weight of 123.08 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-en-2-imine.
| Compound Name | 3,4,4-trifluorobut-3-en-2-imine |
|---|---|
| PubChem CID | 58488810 |
| Molecular Formula | C4H4F3N |
| Molecular Weight | 123.08 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 3,4,4-trifluorobut-3-en-2-imine |
| SMILES | [H]/N=C(\C)C(F)=C(F)F |
| InChI | InChI=1S/C4H4F3N/c1-2(8)3(5)4(6)7/h8H,1H3/b8-2+ |
| InChIKey | DCDYGTYUDLHAOQ-KRXBUXKQSA-N |
| XLogP | 2.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|