About 3-iminobutan-2-one;hydrochloride
3-iminobutan-2-one;hydrochloride (PubChem CID 91594122) has the molecular formula C4H8ClNO
and a molecular weight of 121.57 g/mol. Its IUPAC name is 3-iminobutan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-iminobutan-2-one;hydrochloride |
| PubChem CID | 91594122 |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.57 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 3-iminobutan-2-one;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)C(C)=O |
| InChI | InChI=1S/C4H7NO.ClH/c1-3(5)4(2)6;/h5H,1-2H3;1H/b5-3+; |
| InChIKey | YUOPFXUXUJBYCV-WGCWOXMQSA-N |
| XLogP | 1.04 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.57 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminobutan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminobutan-2-one;hydrochloride?
The IUPAC name of 3-iminobutan-2-one;hydrochloride (CID 91594122) is 3-iminobutan-2-one;hydrochloride.
What is the SMILES notation for 3-iminobutan-2-one;hydrochloride?
The canonical SMILES for 3-iminobutan-2-one;hydrochloride is Cl.[H]/N=C(\C)C(C)=O.
What is the InChIKey of 3-iminobutan-2-one;hydrochloride?
The InChIKey is YUOPFXUXUJBYCV-WGCWOXMQSA-N. The full InChI is InChI=1S/C4H7NO.ClH/c1-3(5)4(2)6;/h5H,1-2H3;1H/b5-3+;.
What are the key properties of 3-iminobutan-2-one;hydrochloride?
3-iminobutan-2-one;hydrochloride has a molecular weight of 121.57 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminobutan-2-one;hydrochloride is sourced from PubChem (CID 91594122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).