About ethanimidamide;propan-2-one;titanium
ethanimidamide;propan-2-one;titanium (PubChem CID 158445220) has the molecular formula C11H30N8OTi
and a molecular weight of 338.28 g/mol. Its IUPAC name is ethanimidamide;propan-2-one;titanium.
Molecular Properties
| Compound Name | ethanimidamide;propan-2-one;titanium |
| PubChem CID | 158445220 |
| Molecular Formula | C11H30N8OTi |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | ethanimidamide;propan-2-one;titanium |
| SMILES | CC(C)=O.[H]/N=C(\C)N.[H]/N=C(\C)N.[H]/N=C(\C)N.[H]/N=C(\C)N.[Ti] |
| InChI | InChI=1S/C3H6O.4C2H6N2.Ti/c1-3(2)4;4*1-2(3)4;/h1-2H3;4*1H3,(H3,3,4); |
| InChIKey | HDHRVFKXQGWCDC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 216.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidamide;propan-2-one;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidamide;propan-2-one;titanium?
The IUPAC name of ethanimidamide;propan-2-one;titanium (CID 158445220) is ethanimidamide;propan-2-one;titanium.
What is the SMILES notation for ethanimidamide;propan-2-one;titanium?
The canonical SMILES for ethanimidamide;propan-2-one;titanium is CC(C)=O.[H]/N=C(\C)N.[H]/N=C(\C)N.[H]/N=C(\C)N.[H]/N=C(\C)N.[Ti].
What is the InChIKey of ethanimidamide;propan-2-one;titanium?
The InChIKey is HDHRVFKXQGWCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.4C2H6N2.Ti/c1-3(2)4;4*1-2(3)4;/h1-2H3;4*1H3,(H3,3,4);.
What are the key properties of ethanimidamide;propan-2-one;titanium?
ethanimidamide;propan-2-one;titanium has a molecular weight of 338.28 g/mol, XLogP of 0.36, 0 rotatable bonds, 8 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidamide;propan-2-one;titanium is sourced from PubChem (CID 158445220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).