About ethanimidamide;hydrate;hydrochloride
ethanimidamide;hydrate;hydrochloride (PubChem CID 160733537) has the molecular formula C2H9ClN2O
and a molecular weight of 112.56 g/mol. Its IUPAC name is ethanimidamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | ethanimidamide;hydrate;hydrochloride |
| PubChem CID | 160733537 |
| Molecular Formula | C2H9ClN2O |
| Molecular Weight | 112.56 g/mol |
| Exact Mass | 112.04 |
| IUPAC Name | ethanimidamide;hydrate;hydrochloride |
| SMILES | Cl.O.[H]/N=C(\C)N |
| InChI | InChI=1S/C2H6N2.ClH.H2O/c1-2(3)4;;/h1H3,(H3,3,4);1H;1H2 |
| InChIKey | RUQQWNHQDGOHJN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.56 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidamide;hydrate;hydrochloride?
The IUPAC name of ethanimidamide;hydrate;hydrochloride (CID 160733537) is ethanimidamide;hydrate;hydrochloride.
What is the SMILES notation for ethanimidamide;hydrate;hydrochloride?
The canonical SMILES for ethanimidamide;hydrate;hydrochloride is Cl.O.[H]/N=C(\C)N.
What is the InChIKey of ethanimidamide;hydrate;hydrochloride?
The InChIKey is RUQQWNHQDGOHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2.ClH.H2O/c1-2(3)4;;/h1H3,(H3,3,4);1H;1H2.
What are the key properties of ethanimidamide;hydrate;hydrochloride?
ethanimidamide;hydrate;hydrochloride has a molecular weight of 112.56 g/mol, XLogP of -0.46, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidamide;hydrate;hydrochloride is sourced from PubChem (CID 160733537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).