About cobalt;ethanimidamide
cobalt;ethanimidamide (PubChem CID 162055614) has the molecular formula C2H6CoN2
and a molecular weight of 117.02 g/mol. Its IUPAC name is cobalt;ethanimidamide.
Molecular Properties
| Compound Name | cobalt;ethanimidamide |
| PubChem CID | 162055614 |
| Molecular Formula | C2H6CoN2 |
| Molecular Weight | 117.02 g/mol |
| Exact Mass | 116.99 |
| IUPAC Name | cobalt;ethanimidamide |
| SMILES | [Co].[H]/N=C(\C)N |
| InChI | InChI=1S/C2H6N2.Co/c1-2(3)4;/h1H3,(H3,3,4); |
| InChIKey | YZDDSEXFPGHGRV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.02 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cobalt;ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;ethanimidamide?
The IUPAC name of cobalt;ethanimidamide (CID 162055614) is cobalt;ethanimidamide.
What is the SMILES notation for cobalt;ethanimidamide?
The canonical SMILES for cobalt;ethanimidamide is [Co].[H]/N=C(\C)N.
What is the InChIKey of cobalt;ethanimidamide?
The InChIKey is YZDDSEXFPGHGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2.Co/c1-2(3)4;/h1H3,(H3,3,4);.
What are the key properties of cobalt;ethanimidamide?
cobalt;ethanimidamide has a molecular weight of 117.02 g/mol, XLogP of -0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;ethanimidamide is sourced from PubChem (CID 162055614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).