About ethanimidamide;guanidine
ethanimidamide;guanidine (PubChem CID 160661984) has the molecular formula C3H11N5
and a molecular weight of 117.16 g/mol. Its IUPAC name is ethanimidamide;guanidine.
Molecular Properties
| Compound Name | ethanimidamide;guanidine |
| PubChem CID | 160661984 |
| Molecular Formula | C3H11N5 |
| Molecular Weight | 117.16 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | ethanimidamide;guanidine |
| SMILES | [H]/N=C(\C)N.[H]N=C(N)N |
| InChI | InChI=1S/C2H6N2.CH5N3/c1-2(3)4;2-1(3)4/h1H3,(H3,3,4);(H5,2,3,4) |
| InChIKey | RLUGRPJLNJKSTO-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.16 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidamide;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidamide;guanidine?
The IUPAC name of ethanimidamide;guanidine (CID 160661984) is ethanimidamide;guanidine.
What is the SMILES notation for ethanimidamide;guanidine?
The canonical SMILES for ethanimidamide;guanidine is [H]/N=C(\C)N.[H]N=C(N)N.
What is the InChIKey of ethanimidamide;guanidine?
The InChIKey is RLUGRPJLNJKSTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2.CH5N3/c1-2(3)4;2-1(3)4/h1H3,(H3,3,4);(H5,2,3,4).
What are the key properties of ethanimidamide;guanidine?
ethanimidamide;guanidine has a molecular weight of 117.16 g/mol, XLogP of -1.22, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidamide;guanidine is sourced from PubChem (CID 160661984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).