About ethanimidamide;propan-2-one;vanadium
ethanimidamide;propan-2-one;vanadium (PubChem CID 159949516) has the molecular formula C5H12N2OV
and a molecular weight of 167.11 g/mol. Its IUPAC name is ethanimidamide;propan-2-one;vanadium.
Molecular Properties
| Compound Name | ethanimidamide;propan-2-one;vanadium |
| PubChem CID | 159949516 |
| Molecular Formula | C5H12N2OV |
| Molecular Weight | 167.11 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | ethanimidamide;propan-2-one;vanadium |
| SMILES | CC(C)=O.[H]/N=C(\C)N.[V] |
| InChI | InChI=1S/C3H6O.C2H6N2.V/c1-3(2)4;1-2(3)4;/h1-2H3;1H3,(H3,3,4); |
| InChIKey | OBXRUBTVSOPWLX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidamide;propan-2-one;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidamide;propan-2-one;vanadium?
The IUPAC name of ethanimidamide;propan-2-one;vanadium (CID 159949516) is ethanimidamide;propan-2-one;vanadium.
What is the SMILES notation for ethanimidamide;propan-2-one;vanadium?
The canonical SMILES for ethanimidamide;propan-2-one;vanadium is CC(C)=O.[H]/N=C(\C)N.[V].
What is the InChIKey of ethanimidamide;propan-2-one;vanadium?
The InChIKey is OBXRUBTVSOPWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H6N2.V/c1-3(2)4;1-2(3)4;/h1-2H3;1H3,(H3,3,4);.
What are the key properties of ethanimidamide;propan-2-one;vanadium?
ethanimidamide;propan-2-one;vanadium has a molecular weight of 167.11 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidamide;propan-2-one;vanadium is sourced from PubChem (CID 159949516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).