C5H8N2O2 — CID 141143667
2,4-dioxopentanimidamide (PubChem CID 141143667) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is 2,4-dioxopentanimidamide.
| Compound Name | 2,4-dioxopentanimidamide |
|---|---|
| PubChem CID | 141143667 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2,4-dioxopentanimidamide |
| SMILES | [H]/N=C(\N)C(=O)CC(C)=O |
| InChI | InChI=1S/C5H8N2O2/c1-3(8)2-4(9)5(6)7/h2H2,1H3,(H3,6,7) |
| InChIKey | CKZGCUDWKUBLLH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|