About 2-iminopropanimidamide
2-iminopropanimidamide (PubChem CID 174066114) has the molecular formula C3H7N3
and a molecular weight of 85.11 g/mol. Its IUPAC name is 2-iminopropanimidamide.
Molecular Properties
| Compound Name | 2-iminopropanimidamide |
| PubChem CID | 174066114 |
| Molecular Formula | C3H7N3 |
| Molecular Weight | 85.11 g/mol |
| Exact Mass | 85.06 |
| IUPAC Name | 2-iminopropanimidamide |
| SMILES | [H]/N=C(N)/C(C)=N/[H] |
| InChI | InChI=1S/C3H7N3/c1-2(4)3(5)6/h4H,1H3,(H3,5,6)/b4-2+ |
| InChIKey | DSIOWFYABIBCFT-DUXPYHPUSA-N |
| XLogP | -0.04 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.11 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-iminopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminopropanimidamide?
The IUPAC name of 2-iminopropanimidamide (CID 174066114) is 2-iminopropanimidamide.
What is the SMILES notation for 2-iminopropanimidamide?
The canonical SMILES for 2-iminopropanimidamide is [H]/N=C(N)/C(C)=N/[H].
What is the InChIKey of 2-iminopropanimidamide?
The InChIKey is DSIOWFYABIBCFT-DUXPYHPUSA-N. The full InChI is InChI=1S/C3H7N3/c1-2(4)3(5)6/h4H,1H3,(H3,5,6)/b4-2+.
What are the key properties of 2-iminopropanimidamide?
2-iminopropanimidamide has a molecular weight of 85.11 g/mol, XLogP of -0.04, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminopropanimidamide is sourced from PubChem (CID 174066114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).