About ethanediimidamide;trihydrochloride
ethanediimidamide;trihydrochloride (PubChem CID 139639987) has the molecular formula C2H9Cl3N4
and a molecular weight of 195.48 g/mol. Its IUPAC name is ethanediimidamide;trihydrochloride.
Molecular Properties
| Compound Name | ethanediimidamide;trihydrochloride |
| PubChem CID | 139639987 |
| Molecular Formula | C2H9Cl3N4 |
| Molecular Weight | 195.48 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | ethanediimidamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.[H]/N=C(N)/C(N)=N/[H] |
| InChI | InChI=1S/C2H6N4.3ClH/c3-1(4)2(5)6;;;/h(H3,3,4)(H3,5,6);3*1H |
| InChIKey | KXOFUUASPAGCPE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.48 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanediimidamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanediimidamide;trihydrochloride?
The IUPAC name of ethanediimidamide;trihydrochloride (CID 139639987) is ethanediimidamide;trihydrochloride.
What is the SMILES notation for ethanediimidamide;trihydrochloride?
The canonical SMILES for ethanediimidamide;trihydrochloride is Cl.Cl.Cl.[H]/N=C(N)/C(N)=N/[H].
What is the InChIKey of ethanediimidamide;trihydrochloride?
The InChIKey is KXOFUUASPAGCPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N4.3ClH/c3-1(4)2(5)6;;;/h(H3,3,4)(H3,5,6);3*1H.
What are the key properties of ethanediimidamide;trihydrochloride?
ethanediimidamide;trihydrochloride has a molecular weight of 195.48 g/mol, XLogP of 0.12, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanediimidamide;trihydrochloride is sourced from PubChem (CID 139639987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).