About CID 174391315
CID 174391315 (PubChem CID 174391315) has the molecular formula CH4FN2Se
and a molecular weight of 142.02 g/mol.
Molecular Properties
| Compound Name | CID 174391315 |
| PubChem CID | 174391315 |
| Molecular Formula | CH4FN2Se |
| Molecular Weight | 142.02 g/mol |
| Exact Mass | 142.95 |
| IUPAC Name | — |
| SMILES | F.[H]/N=C(/N)[Se] |
| InChI | InChI=1S/CH3N2Se.FH/c2-1(3)4;/h(H3,2,3);1H |
| InChIKey | HDFDHCUOQLUWCG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.02 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174391315 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174391315?
The IUPAC name of CID 174391315 (CID 174391315) is not available.
What is the SMILES notation for CID 174391315?
The canonical SMILES for CID 174391315 is F.[H]/N=C(/N)[Se].
What is the InChIKey of CID 174391315?
The InChIKey is HDFDHCUOQLUWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3N2Se.FH/c2-1(3)4;/h(H3,2,3);1H.
What are the key properties of CID 174391315?
CID 174391315 has a molecular weight of 142.02 g/mol, XLogP of -0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174391315 is sourced from PubChem (CID 174391315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).