About carbamimidoyl fluoride;λ2-plumbane
carbamimidoyl fluoride;λ2-plumbane (PubChem CID 175191014) has the molecular formula CH5FN2Pb
and a molecular weight of 271.26 g/mol. Its IUPAC name is carbamimidoyl fluoride;λ2-plumbane.
Molecular Properties
| Compound Name | carbamimidoyl fluoride;λ2-plumbane |
| PubChem CID | 175191014 |
| Molecular Formula | CH5FN2Pb |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | carbamimidoyl fluoride;λ2-plumbane |
| SMILES | [H]/N=C(/N)F.[PbH2] |
| InChI | InChI=1S/CH3FN2.Pb.2H/c2-1(3)4;;;/h(H3,3,4);;; |
| InChIKey | MSOPWFZEPYZDAL-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl fluoride;λ2-plumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl fluoride;λ2-plumbane?
The IUPAC name of carbamimidoyl fluoride;λ2-plumbane (CID 175191014) is carbamimidoyl fluoride;λ2-plumbane.
What is the SMILES notation for carbamimidoyl fluoride;λ2-plumbane?
The canonical SMILES for carbamimidoyl fluoride;λ2-plumbane is [H]/N=C(/N)F.[PbH2].
What is the InChIKey of carbamimidoyl fluoride;λ2-plumbane?
The InChIKey is MSOPWFZEPYZDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3FN2.Pb.2H/c2-1(3)4;;;/h(H3,3,4);;;.
What are the key properties of carbamimidoyl fluoride;λ2-plumbane?
carbamimidoyl fluoride;λ2-plumbane has a molecular weight of 271.26 g/mol, XLogP of -1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl fluoride;λ2-plumbane is sourced from PubChem (CID 175191014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).