About 1-methylideneguanidine;hydrate
1-methylideneguanidine;hydrate (PubChem CID 173023298) has the molecular formula C2H7N3O
and a molecular weight of 89.10 g/mol. Its IUPAC name is 1-methylideneguanidine;hydrate.
Molecular Properties
| Compound Name | 1-methylideneguanidine;hydrate |
| PubChem CID | 173023298 |
| Molecular Formula | C2H7N3O |
| Molecular Weight | 89.10 g/mol |
| Exact Mass | 89.06 |
| IUPAC Name | 1-methylideneguanidine;hydrate |
| SMILES | O.[H]/N=C(\N)N=C |
| InChI | InChI=1S/C2H5N3.H2O/c1-5-2(3)4;/h1H2,(H3,3,4);1H2 |
| InChIKey | NZABAZSIOODNGD-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.10 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylideneguanidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylideneguanidine;hydrate?
The IUPAC name of 1-methylideneguanidine;hydrate (CID 173023298) is 1-methylideneguanidine;hydrate.
What is the SMILES notation for 1-methylideneguanidine;hydrate?
The canonical SMILES for 1-methylideneguanidine;hydrate is O.[H]/N=C(\N)N=C.
What is the InChIKey of 1-methylideneguanidine;hydrate?
The InChIKey is NZABAZSIOODNGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3.H2O/c1-5-2(3)4;/h1H2,(H3,3,4);1H2.
What are the key properties of 1-methylideneguanidine;hydrate?
1-methylideneguanidine;hydrate has a molecular weight of 89.10 g/mol, XLogP of -1.24, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylideneguanidine;hydrate is sourced from PubChem (CID 173023298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).