About azane;1-methylideneguanidine;hydrochloride
azane;1-methylideneguanidine;hydrochloride (PubChem CID 174872522) has the molecular formula C2H9ClN4
and a molecular weight of 124.58 g/mol. Its IUPAC name is azane;1-methylideneguanidine;hydrochloride.
Molecular Properties
| Compound Name | azane;1-methylideneguanidine;hydrochloride |
| PubChem CID | 174872522 |
| Molecular Formula | C2H9ClN4 |
| Molecular Weight | 124.58 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | azane;1-methylideneguanidine;hydrochloride |
| SMILES | Cl.N.[H]/N=C(\N)N=C |
| InChI | InChI=1S/C2H5N3.ClH.H3N/c1-5-2(3)4;;/h1H2,(H3,3,4);1H;1H3 |
| InChIKey | WZOUOOLURXFRRU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.58 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1-methylideneguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-methylideneguanidine;hydrochloride?
The IUPAC name of azane;1-methylideneguanidine;hydrochloride (CID 174872522) is azane;1-methylideneguanidine;hydrochloride.
What is the SMILES notation for azane;1-methylideneguanidine;hydrochloride?
The canonical SMILES for azane;1-methylideneguanidine;hydrochloride is Cl.N.[H]/N=C(\N)N=C.
What is the InChIKey of azane;1-methylideneguanidine;hydrochloride?
The InChIKey is WZOUOOLURXFRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3.ClH.H3N/c1-5-2(3)4;;/h1H2,(H3,3,4);1H;1H3.
What are the key properties of azane;1-methylideneguanidine;hydrochloride?
azane;1-methylideneguanidine;hydrochloride has a molecular weight of 124.58 g/mol, XLogP of 0.16, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-methylideneguanidine;hydrochloride is sourced from PubChem (CID 174872522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).