C5H9N3 — CID 174821814
1,1-bis(ethenyl)guanidine (PubChem CID 174821814) has the molecular formula C5H9N3 and a molecular weight of 111.15 g/mol. Its IUPAC name is 1,1-bis(ethenyl)guanidine.
| Compound Name | 1,1-bis(ethenyl)guanidine |
|---|---|
| PubChem CID | 174821814 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1,1-bis(ethenyl)guanidine |
| SMILES | [H]/N=C(\N)N(C=C)C=C |
| InChI | InChI=1S/C5H9N3/c1-3-8(4-2)5(6)7/h3-4H,1-2H2,(H3,6,7) |
| InChIKey | XRJYFUQDXYMYHQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|