About 1,1-bis(ethenyl)guanidine
1,1-bis(ethenyl)guanidine (PubChem CID 174821814) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 1,1-bis(ethenyl)guanidine.
Molecular Properties
| Compound Name | 1,1-bis(ethenyl)guanidine |
| PubChem CID | 174821814 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1,1-bis(ethenyl)guanidine |
| SMILES | [H]/N=C(\N)N(C=C)C=C |
| InChI | InChI=1S/C5H9N3/c1-3-8(4-2)5(6)7/h3-4H,1-2H2,(H3,6,7) |
| InChIKey | XRJYFUQDXYMYHQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(ethenyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(ethenyl)guanidine?
The IUPAC name of 1,1-bis(ethenyl)guanidine (CID 174821814) is 1,1-bis(ethenyl)guanidine.
What is the SMILES notation for 1,1-bis(ethenyl)guanidine?
The canonical SMILES for 1,1-bis(ethenyl)guanidine is [H]/N=C(\N)N(C=C)C=C.
What is the InChIKey of 1,1-bis(ethenyl)guanidine?
The InChIKey is XRJYFUQDXYMYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-3-8(4-2)5(6)7/h3-4H,1-2H2,(H3,6,7).
What are the key properties of 1,1-bis(ethenyl)guanidine?
1,1-bis(ethenyl)guanidine has a molecular weight of 111.15 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(ethenyl)guanidine is sourced from PubChem (CID 174821814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).