C6H12N3O4P — CID 175025141
[2-[carbamimidoyl(methyl)amino]acetyl]oxy-ethenylphosphinic acid (PubChem CID 175025141) has the molecular formula C6H12N3O4P and a molecular weight of 221.15 g/mol. Its IUPAC name is [2-[carbamimidoyl(methyl)amino]acetyl]oxy-ethenylphosphinic acid.
| Compound Name | [2-[carbamimidoyl(methyl)amino]acetyl]oxy-ethenylphosphinic acid |
|---|---|
| PubChem CID | 175025141 |
| Molecular Formula | C6H12N3O4P |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | [2-[carbamimidoyl(methyl)amino]acetyl]oxy-ethenylphosphinic acid |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OP(=O)(O)C=C |
| InChI | InChI=1S/C6H12N3O4P/c1-3-14(11,12)13-5(10)4-9(2)6(7)8/h3H,1,4H2,2H3,(H3,7,8)(H,11,12) |
| InChIKey | XUUVAYFURGHRHQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|