C11H23N7O4 — CID 168759070
[2-amino-3-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropyl] 2-[carbamimidoyl(methyl)amino]acetate (PubChem CID 168759070) has the molecular formula C11H23N7O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is [2-amino-3-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropyl] 2-[carbamimidoyl(methyl)amino]acetate.
| Compound Name | [2-amino-3-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropyl] 2-[carbamimidoyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 168759070 |
| Molecular Formula | C11H23N7O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [2-amino-3-[2-[carbamimidoyl(methyl)amino]acetyl]oxypropyl] 2-[carbamimidoyl(methyl)amino]acetate |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OCC(N)COC(=O)CN(C)/C(N)=N/[H] |
| InChI | InChI=1S/C11H23N7O4/c1-17(10(13)14)3-8(19)21-5-7(12)6-22-9(20)4-18(2)11(15)16/h7H,3-6,12H2,1-2H3,(H3,13,14)(H3,15,16) |
| InChIKey | OBSDPLXBMYMBQR-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|