C11H21N3O6 — CID 144761289
(6-formyloxy-3,4-dihydroxyhexyl) 2-[carbamimidoyl(methyl)amino]acetate (PubChem CID 144761289) has the molecular formula C11H21N3O6 and a molecular weight of 291.30 g/mol. Its IUPAC name is (6-formyloxy-3,4-dihydroxyhexyl) 2-[carbamimidoyl(methyl)amino]acetate.
| Compound Name | (6-formyloxy-3,4-dihydroxyhexyl) 2-[carbamimidoyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 144761289 |
| Molecular Formula | C11H21N3O6 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (6-formyloxy-3,4-dihydroxyhexyl) 2-[carbamimidoyl(methyl)amino]acetate |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OCCC(O)C(O)CCOC=O |
| InChI | InChI=1S/C11H21N3O6/c1-14(11(12)13)6-10(18)20-5-3-9(17)8(16)2-4-19-7-15/h7-9,16-17H,2-6H2,1H3,(H3,12,13) |
| InChIKey | XDTCSNXYCNNHKW-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|