C4H9CrN3O2 — CID 174525318
2-[carbamimidoyl(methyl)amino]acetic acid;chromium (PubChem CID 174525318) has the molecular formula C4H9CrN3O2 and a molecular weight of 183.13 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;chromium.
| Compound Name | 2-[carbamimidoyl(methyl)amino]acetic acid;chromium |
|---|---|
| PubChem CID | 174525318 |
| Molecular Formula | C4H9CrN3O2 |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid;chromium |
| SMILES | [Cr].[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C4H9N3O2.Cr/c1-7(4(5)6)2-3(8)9;/h2H2,1H3,(H3,5,6)(H,8,9); |
| InChIKey | UKFGMPUDDGLPIH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|