C7H13N3O6 — CID 139530070
2-[carbamimidoyl(methyl)amino]acetic acid;propanedioic acid (PubChem CID 139530070) has the molecular formula C7H13N3O6 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;propanedioic acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]acetic acid;propanedioic acid |
|---|---|
| PubChem CID | 139530070 |
| Molecular Formula | C7H13N3O6 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C4H9N3O2.C3H4O4/c1-7(4(5)6)2-3(8)9;4-2(5)1-3(6)7/h2H2,1H3,(H3,5,6)(H,8,9);1H2,(H,4,5)(H,6,7) |
| InChIKey | FWBIDPGIHSPSAY-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 165.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|