2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid

C8H15N3O7 — CID 10355479

IUPAC2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid
SMILESO=C(O)CC(O)C(=O)O.[H]/N=C(\N)N(C)CC(=O)O
InChIInChI=1S/C4H9N3O2.C4H6O5/c1-7(4(5)6)2-3(8)9;5-2(4(8)9)1-3(6)7/h2H2,1H3,(H3,5,6)(H,8,9);2,5H,1H2,(H,6,7)(H,8,9)
InChIKeyIJHJWHALYRGNKV-UHFFFAOYSA-N
MW265.22 g/mol
LogP-2.20
Rot. Bonds5

About 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid

2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid (PubChem CID 10355479) has the molecular formula C8H15N3O7 and a molecular weight of 265.22 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid.

Molecular Properties

Compound Name2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid
PubChem CID10355479
Molecular FormulaC8H15N3O7
Molecular Weight265.22 g/mol
Exact Mass265.09
IUPAC Name2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid
SMILESO=C(O)CC(O)C(=O)O.[H]/N=C(\N)N(C)CC(=O)O
InChIInChI=1S/C4H9N3O2.C4H6O5/c1-7(4(5)6)2-3(8)9;5-2(4(8)9)1-3(6)7/h2H2,1H3,(H3,5,6)(H,8,9);2,5H,1H2,(H,6,7)(H,8,9)
InChIKeyIJHJWHALYRGNKV-UHFFFAOYSA-N
XLogP-2.20
TPSA185.24 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500265.22
LogP ≤ 5-2.20
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid?
The IUPAC name of 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid (CID 10355479) is 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid.
What is the SMILES notation for 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid?
The canonical SMILES for 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid is O=C(O)CC(O)C(=O)O.[H]/N=C(\N)N(C)CC(=O)O.
What is the InChIKey of 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid?
The InChIKey is IJHJWHALYRGNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O2.C4H6O5/c1-7(4(5)6)2-3(8)9;5-2(4(8)9)1-3(6)7/h2H2,1H3,(H3,5,6)(H,8,9);2,5H,1H2,(H,6,7)(H,8,9).
What are the key properties of 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid?
2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid has a molecular weight of 265.22 g/mol, XLogP of -2.20, 5 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioic acid is sourced from PubChem (CID 10355479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).