C8H16N4O6 — CID 10286051
2-aminobutanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid (PubChem CID 10286051) has the molecular formula C8H16N4O6 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-aminobutanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid.
| Compound Name | 2-aminobutanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 10286051 |
| Molecular Formula | C8H16N4O6 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-aminobutanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid |
| SMILES | NC(CC(=O)O)C(=O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C4H9N3O2.C4H7NO4/c1-7(4(5)6)2-3(8)9;5-2(4(8)9)1-3(6)7/h2H2,1H3,(H3,5,6)(H,8,9);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | OYJBHPWGIDGWFV-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 191.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|