C9H18N4O6 — CID 87803382
(2S)-2-aminopentanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid (PubChem CID 87803382) has the molecular formula C9H18N4O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid.
| Compound Name | (2S)-2-aminopentanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 87803382 |
| Molecular Formula | C9H18N4O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;2-[carbamimidoyl(methyl)amino]acetic acid |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C5H9NO4.C4H9N3O2/c6-3(5(9)10)1-2-4(7)8;1-7(4(5)6)2-3(8)9/h3H,1-2,6H2,(H,7,8)(H,9,10);2H2,1H3,(H3,5,6)(H,8,9)/t3-;/m0./s1 |
| InChIKey | DYYMWGVLTAGCPW-DFWYDOINSA-N |
| XLogP | -1.84 |
| TPSA | 191.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|