C12H25N3O4S2 — CID 10236840
6,8-bis(sulfanyl)octanoic acid;2-[carbamimidoyl(methyl)amino]acetic acid (PubChem CID 10236840) has the molecular formula C12H25N3O4S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 6,8-bis(sulfanyl)octanoic acid;2-[carbamimidoyl(methyl)amino]acetic acid.
| Compound Name | 6,8-bis(sulfanyl)octanoic acid;2-[carbamimidoyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 10236840 |
| Molecular Formula | C12H25N3O4S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 6,8-bis(sulfanyl)octanoic acid;2-[carbamimidoyl(methyl)amino]acetic acid |
| SMILES | O=C(O)CCCCC(S)CCS.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C8H16O2S2.C4H9N3O2/c9-8(10)4-2-1-3-7(12)5-6-11;1-7(4(5)6)2-3(8)9/h7,11-12H,1-6H2,(H,9,10);2H2,1H3,(H3,5,6)(H,8,9) |
| InChIKey | JRFPWENLLUGSCT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|