C7H12N3NaO5 — CID 23721155
sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate (PubChem CID 23721155) has the molecular formula C7H12N3NaO5 and a molecular weight of 241.18 g/mol. Its IUPAC name is sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate.
| Compound Name | sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate |
|---|---|
| PubChem CID | 23721155 |
| Molecular Formula | C7H12N3NaO5 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate |
| SMILES | CC(=O)C(=O)[O-].[H]/N=C(\N)N(C)CC(=O)O.[Na+] |
| InChI | InChI=1S/C4H9N3O2.C3H4O3.Na/c1-7(4(5)6)2-3(8)9;1-2(4)3(5)6;/h2H2,1H3,(H3,5,6)(H,8,9);1H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | CTORLXDTHCJUQV-UHFFFAOYSA-M |
| XLogP | -5.77 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|