About sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate
sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate (PubChem CID 23721155) has the molecular formula C7H12N3NaO5
and a molecular weight of 241.18 g/mol. Its IUPAC name is sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate.
Molecular Properties
| Compound Name | sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate |
| PubChem CID | 23721155 |
| Molecular Formula | C7H12N3NaO5 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate |
| SMILES | CC(=O)C(=O)[O-].[H]/N=C(\N)N(C)CC(=O)O.[Na+] |
| InChI | InChI=1S/C4H9N3O2.C3H4O3.Na/c1-7(4(5)6)2-3(8)9;1-2(4)3(5)6;/h2H2,1H3,(H3,5,6)(H,8,9);1H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | CTORLXDTHCJUQV-UHFFFAOYSA-M |
| XLogP | -5.77 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate?
The IUPAC name of sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate (CID 23721155) is sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate.
What is the SMILES notation for sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate?
The canonical SMILES for sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate is CC(=O)C(=O)[O-].[H]/N=C(\N)N(C)CC(=O)O.[Na+].
What is the InChIKey of sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate?
The InChIKey is CTORLXDTHCJUQV-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9N3O2.C3H4O3.Na/c1-7(4(5)6)2-3(8)9;1-2(4)3(5)6;/h2H2,1H3,(H3,5,6)(H,8,9);1H3,(H,5,6);/q;;+1/p-1.
What are the key properties of sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate?
sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate has a molecular weight of 241.18 g/mol, XLogP of -5.77, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoate is sourced from PubChem (CID 23721155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).