C8H13N3O7-2 — CID 171391165
2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioate (PubChem CID 171391165) has the molecular formula C8H13N3O7-2 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioate.
| Compound Name | 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioate |
|---|---|
| PubChem CID | 171391165 |
| Molecular Formula | C8H13N3O7-2 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid;2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)C(=O)[O-].[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C4H9N3O2.C4H6O5/c1-7(4(5)6)2-3(8)9;5-2(4(8)9)1-3(6)7/h2H2,1H3,(H3,5,6)(H,8,9);2,5H,1H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | IJHJWHALYRGNKV-UHFFFAOYSA-L |
| XLogP | -4.87 |
| TPSA | 190.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|