C11H27N4O9P — CID 174395686
2-[carbamimidoyl(methyl)amino]acetic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;phosphoric acid (PubChem CID 174395686) has the molecular formula C11H27N4O9P and a molecular weight of 390.33 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;phosphoric acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]acetic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;phosphoric acid |
|---|---|
| PubChem CID | 174395686 |
| Molecular Formula | C11H27N4O9P |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;phosphoric acid |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-].O=P(O)(O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C7H15NO3.C4H9N3O2.H3O4P/c1-8(2,3)5-6(9)4-7(10)11;1-7(4(5)6)2-3(8)9;1-5(2,3)4/h6,9H,4-5H2,1-3H3;2H2,1H3,(H3,5,6)(H,8,9);(H3,1,2,3,4) |
| InChIKey | JVWMVSZVPWEFTG-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 228.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|