C14H26N6O12 — CID 140506264
bis(2-[carbamimidoyl(methyl)amino]acetic acid);1,2-dihydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 140506264) has the molecular formula C14H26N6O12 and a molecular weight of 470.39 g/mol. Its IUPAC name is bis(2-[carbamimidoyl(methyl)amino]acetic acid);1,2-dihydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | bis(2-[carbamimidoyl(methyl)amino]acetic acid);1,2-dihydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 140506264 |
| Molecular Formula | C14H26N6O12 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | bis(2-[carbamimidoyl(methyl)amino]acetic acid);1,2-dihydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(O)C(=O)O.[H]/N=C(\N)N(C)CC(=O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C6H8O8.2C4H9N3O2/c7-2(8)1-6(14,5(12)13)3(9)4(10)11;2*1-7(4(5)6)2-3(8)9/h3,9,14H,1H2,(H,7,8)(H,10,11)(H,12,13);2*2H2,1H3,(H3,5,6)(H,8,9) |
| InChIKey | HCSYAJXTYHQCFD-UHFFFAOYSA-N |
| XLogP | -4.49 |
| TPSA | 333.18 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|