About methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate
methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate (PubChem CID 123444259) has the molecular formula C5H11N3O2S
and a molecular weight of 177.23 g/mol. Its IUPAC name is methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate.
Molecular Properties
| Compound Name | methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate |
| PubChem CID | 123444259 |
| Molecular Formula | C5H11N3O2S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OSC |
| InChI | InChI=1S/C5H11N3O2S/c1-8(5(6)7)3-4(9)10-11-2/h3H2,1-2H3,(H3,6,7) |
| InChIKey | GAUIHZUVFDCDHN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate?
The IUPAC name of methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate (CID 123444259) is methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate.
What is the SMILES notation for methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate?
The canonical SMILES for methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate is [H]/N=C(\N)N(C)CC(=O)OSC.
What is the InChIKey of methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate?
The InChIKey is GAUIHZUVFDCDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2S/c1-8(5(6)7)3-4(9)10-11-2/h3H2,1-2H3,(H3,6,7).
What are the key properties of methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate?
methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate has a molecular weight of 177.23 g/mol, XLogP of -0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl 2-[carbamimidoyl(methyl)amino]acetate is sourced from PubChem (CID 123444259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).