About 1-iodo-1-methylguanidine
1-iodo-1-methylguanidine (PubChem CID 174838872) has the molecular formula C2H6IN3
and a molecular weight of 199.00 g/mol. Its IUPAC name is 1-iodo-1-methylguanidine.
Molecular Properties
| Compound Name | 1-iodo-1-methylguanidine |
| PubChem CID | 174838872 |
| Molecular Formula | C2H6IN3 |
| Molecular Weight | 199.00 g/mol |
| Exact Mass | 198.96 |
| IUPAC Name | 1-iodo-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)I |
| InChI | InChI=1S/C2H6IN3/c1-6(3)2(4)5/h1H3,(H3,4,5) |
| InChIKey | YIVGBBLZTAUFAY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.00 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1-methylguanidine?
The IUPAC name of 1-iodo-1-methylguanidine (CID 174838872) is 1-iodo-1-methylguanidine.
What is the SMILES notation for 1-iodo-1-methylguanidine?
The canonical SMILES for 1-iodo-1-methylguanidine is [H]/N=C(\N)N(C)I.
What is the InChIKey of 1-iodo-1-methylguanidine?
The InChIKey is YIVGBBLZTAUFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6IN3/c1-6(3)2(4)5/h1H3,(H3,4,5).
What are the key properties of 1-iodo-1-methylguanidine?
1-iodo-1-methylguanidine has a molecular weight of 199.00 g/mol, XLogP of 0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1-methylguanidine is sourced from PubChem (CID 174838872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).