C5H13IN6O2 — CID 159967357
2-aminoacetic acid;3-(diaminomethylidene)-1-iodo-1-methylguanidine (PubChem CID 159967357) has the molecular formula C5H13IN6O2 and a molecular weight of 316.10 g/mol. Its IUPAC name is 2-aminoacetic acid;3-(diaminomethylidene)-1-iodo-1-methylguanidine.
| Compound Name | 2-aminoacetic acid;3-(diaminomethylidene)-1-iodo-1-methylguanidine |
|---|---|
| PubChem CID | 159967357 |
| Molecular Formula | C5H13IN6O2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-aminoacetic acid;3-(diaminomethylidene)-1-iodo-1-methylguanidine |
| SMILES | NCC(=O)O.[H]/N=C(/N=C(N)N)N(C)I |
| InChI | InChI=1S/C3H8IN5.C2H5NO2/c1-9(4)3(7)8-2(5)6;3-1-2(4)5/h1H3,(H5,5,6,7,8);1,3H2,(H,4,5) |
| InChIKey | VCZYUOIZRTWWCT-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|