C13H28N6O5 — CID 90479987
3-[(2-deuteriooxy-4-hydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;3-(diaminomethylidene)-1,1-dimethylguanidine (PubChem CID 90479987) has the molecular formula C13H28N6O5 and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-[(2-deuteriooxy-4-hydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;3-(diaminomethylidene)-1,1-dimethylguanidine.
| Compound Name | 3-[(2-deuteriooxy-4-hydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;3-(diaminomethylidene)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 90479987 |
| Molecular Formula | C13H28N6O5 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 3-[(2-deuteriooxy-4-hydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;3-(diaminomethylidene)-1,1-dimethylguanidine |
| SMILES | [2H]OC(C(=O)NCCC(=O)O)C(C)(C)CO.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C9H17NO5.C4H11N5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;1-9(2)4(7)8-3(5)6/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);1-2H3,(H5,5,6,7,8)/i14D; |
| InChIKey | NGGJXADMLIXXAR-CDOHMJNASA-N |
| XLogP | -2.29 |
| TPSA | 198.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|