C7H17N5O3 — CID 46892505
3-(diaminomethylidene)-1,1-dimethylguanidine;2-hydroxypropanoic acid (PubChem CID 46892505) has the molecular formula C7H17N5O3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine;2-hydroxypropanoic acid.
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 46892505 |
| Molecular Formula | C7H17N5O3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C4H11N5.C3H6O3/c1-9(2)4(7)8-3(5)6;1-2(4)3(5)6/h1-2H3,(H5,5,6,7,8);2,4H,1H3,(H,5,6) |
| InChIKey | ZHELAHPEMIIBKC-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|