C25H25N5O7 — CID 71471331
3-(diaminomethylidene)-1,1-dimethylguanidine;2-[2-(2-hydroxybenzoyl)oxybenzoyl]oxybenzoic acid (PubChem CID 71471331) has the molecular formula C25H25N5O7 and a molecular weight of 507.50 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine;2-[2-(2-hydroxybenzoyl)oxybenzoyl]oxybenzoic acid.
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-[2-(2-hydroxybenzoyl)oxybenzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 71471331 |
| Molecular Formula | C25H25N5O7 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-[2-(2-hydroxybenzoyl)oxybenzoyl]oxybenzoic acid |
| SMILES | O=C(Oc1ccccc1C(=O)Oc1ccccc1C(=O)O)c1ccccc1O.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C21H14O7.C4H11N5/c22-16-10-4-1-7-13(16)20(25)28-18-12-6-3-9-15(18)21(26)27-17-11-5-2-8-14(17)19(23)24;1-9(2)4(7)8-3(5)6/h1-12,22H,(H,23,24);1-2H3,(H5,5,6,7,8) |
| InChIKey | JMTWBVYREMAHFS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 201.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|