C21H27NO5 — CID 69490317
N,N-diethylethanamine;(2-methoxycarbonylphenyl) 2-hydroxybenzoate (PubChem CID 69490317) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is N,N-diethylethanamine;(2-methoxycarbonylphenyl) 2-hydroxybenzoate.
| Compound Name | N,N-diethylethanamine;(2-methoxycarbonylphenyl) 2-hydroxybenzoate |
|---|---|
| PubChem CID | 69490317 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N,N-diethylethanamine;(2-methoxycarbonylphenyl) 2-hydroxybenzoate |
| SMILES | CCN(CC)CC.COC(=O)c1ccccc1OC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H12O5.C6H15N/c1-19-14(17)11-7-3-5-9-13(11)20-15(18)10-6-2-4-8-12(10)16;1-4-7(5-2)6-3/h2-9,16H,1H3;4-6H2,1-3H3 |
| InChIKey | JJJJSPQBNPMAFI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|