C7H13N3O5 — CID 141283328
2-[carbamimidoyl(methyl)amino]-2-(2-hydroxypropanoyloxy)acetic acid (PubChem CID 141283328) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-2-(2-hydroxypropanoyloxy)acetic acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]-2-(2-hydroxypropanoyloxy)acetic acid |
|---|---|
| PubChem CID | 141283328 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-2-(2-hydroxypropanoyloxy)acetic acid |
| SMILES | [H]/N=C(\N)N(C)C(OC(=O)C(C)O)C(=O)O |
| InChI | InChI=1S/C7H13N3O5/c1-3(11)6(14)15-4(5(12)13)10(2)7(8)9/h3-4,11H,1-2H3,(H3,8,9)(H,12,13) |
| InChIKey | WABSIWKHFGWDKJ-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|