C5H11N3O2 — CID 176514595
2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid (PubChem CID 176514595) has the molecular formula C5H11N3O2 and a molecular weight of 148.18 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid |
|---|---|
| PubChem CID | 176514595 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid |
| SMILES | [H]/N=C(\N)N(C)C(C(=O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C5H11N3O2/c1-3(4(9)10)8(2)5(6)7/h3H,1-2H3,(H3,6,7)(H,9,10)/i1D3 |
| InChIKey | LWYWAUJJEVGBLG-FIBGUPNXSA-N |
| XLogP | -0.72 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|