About 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid
2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid (PubChem CID 176514595) has the molecular formula C5H11N3O2
and a molecular weight of 148.18 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid.
Molecular Properties
| Compound Name | 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid |
| PubChem CID | 176514595 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid |
| SMILES | [H]/N=C(\N)N(C)C(C(=O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C5H11N3O2/c1-3(4(9)10)8(2)5(6)7/h3H,1-2H3,(H3,6,7)(H,9,10)/i1D3 |
| InChIKey | LWYWAUJJEVGBLG-FIBGUPNXSA-N |
| XLogP | -0.72 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid?
The IUPAC name of 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid (CID 176514595) is 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid.
What is the SMILES notation for 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid?
The canonical SMILES for 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid is [H]/N=C(\N)N(C)C(C(=O)O)C([2H])([2H])[2H].
What is the InChIKey of 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid?
The InChIKey is LWYWAUJJEVGBLG-FIBGUPNXSA-N. The full InChI is InChI=1S/C5H11N3O2/c1-3(4(9)10)8(2)5(6)7/h3H,1-2H3,(H3,6,7)(H,9,10)/i1D3.
What are the key properties of 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid?
2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid has a molecular weight of 148.18 g/mol, XLogP of -0.72, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carbamimidoyl(methyl)amino]-3,3,3-trideuteriopropanoic acid is sourced from PubChem (CID 176514595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).