C4H9N3O5S — CID 140979869
2-[carbamimidoyl(methyl)amino]-2-sulfoacetic acid (PubChem CID 140979869) has the molecular formula C4H9N3O5S and a molecular weight of 211.20 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-2-sulfoacetic acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]-2-sulfoacetic acid |
|---|---|
| PubChem CID | 140979869 |
| Molecular Formula | C4H9N3O5S |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-2-sulfoacetic acid |
| SMILES | [H]/N=C(\N)N(C)C(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C4H9N3O5S/c1-7(4(5)6)2(3(8)9)13(10,11)12/h2H,1H3,(H3,5,6)(H,8,9)(H,10,11,12) |
| InChIKey | WLSICYWGKVUZAD-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|