C6H13N3O2 — CID 145181613
2-[methyl-(N'-methylcarbamimidoyl)amino]propanoic acid (PubChem CID 145181613) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-[methyl-(N'-methylcarbamimidoyl)amino]propanoic acid.
| Compound Name | 2-[methyl-(N'-methylcarbamimidoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 145181613 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-[methyl-(N'-methylcarbamimidoyl)amino]propanoic acid |
| SMILES | C/N=C(\N)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C6H13N3O2/c1-4(5(10)11)9(3)6(7)8-2/h4H,1-3H3,(H2,7,8)(H,10,11) |
| InChIKey | PAZCQAOILQLDAV-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|