C23H44N3O11P — CID 91449622
2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]propanoic acid (PubChem CID 91449622) has the molecular formula C23H44N3O11P and a molecular weight of 569.59 g/mol. Its IUPAC name is 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]propanoic acid.
| Compound Name | 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 91449622 |
| Molecular Formula | C23H44N3O11P |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]propanoic acid |
| SMILES | CCCCOC(=O)OCCCCOP(=O)(N=C(N)N(C)C(C)C(=O)O)OCCCCOC(=O)OCCCC |
| InChI | InChI=1S/C23H44N3O11P/c1-5-7-13-32-22(29)34-15-9-11-17-36-38(31,25-21(24)26(4)19(3)20(27)28)37-18-12-10-16-35-23(30)33-14-8-6-2/h19H,5-18H2,1-4H3,(H,27,28)(H2,24,25,31) |
| InChIKey | JWSXMEPHDTYIBZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|