C22H40N3O11P — CID 91157861
2-[[N'-[bis(3-ethoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]-2-cyclohexylacetic acid (PubChem CID 91157861) has the molecular formula C22H40N3O11P and a molecular weight of 553.55 g/mol. Its IUPAC name is 2-[[N'-[bis(3-ethoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]-2-cyclohexylacetic acid.
| Compound Name | 2-[[N'-[bis(3-ethoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 91157861 |
| Molecular Formula | C22H40N3O11P |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[[N'-[bis(3-ethoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]-2-cyclohexylacetic acid |
| SMILES | CCOC(=O)OCCCOP(=O)(N=C(N)N(C)C(C(=O)O)C1CCCCC1)OCCCOC(=O)OCC |
| InChI | InChI=1S/C22H40N3O11P/c1-4-31-21(28)33-13-9-15-35-37(30,36-16-10-14-34-22(29)32-5-2)24-20(23)25(3)18(19(26)27)17-11-7-6-8-12-17/h17-18H,4-16H2,1-3H3,(H,26,27)(H2,23,24,30) |
| InChIKey | STLITXWQRREFFS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|