C25H48N3O11P — CID 154433187
methyl 2-[[N'-[bis(4-pentoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 154433187) has the molecular formula C25H48N3O11P and a molecular weight of 597.64 g/mol. Its IUPAC name is methyl 2-[[N'-[bis(4-pentoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate.
| Compound Name | methyl 2-[[N'-[bis(4-pentoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 154433187 |
| Molecular Formula | C25H48N3O11P |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | methyl 2-[[N'-[bis(4-pentoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CCCCCOC(=O)OCCCCOP(=O)(N=C(N)N(C)CC(=O)OC)OCCCCOC(=O)OCCCCC |
| InChI | InChI=1S/C25H48N3O11P/c1-5-7-9-15-34-24(30)36-17-11-13-19-38-40(32,27-23(26)28(3)21-22(29)33-4)39-20-14-12-18-37-25(31)35-16-10-8-6-2/h5-21H2,1-4H3,(H2,26,27,32) |
| InChIKey | JEVRYTGFSXIUTM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|