C34H50N3O11P — CID 154433247
butyl 2-[[N'-[bis[4-(2-phenylethoxycarbonyloxy)butoxy]phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 154433247) has the molecular formula C34H50N3O11P and a molecular weight of 707.76 g/mol. Its IUPAC name is butyl 2-[[N'-[bis[4-(2-phenylethoxycarbonyloxy)butoxy]phosphoryl]carbamimidoyl]-methylamino]acetate.
| Compound Name | butyl 2-[[N'-[bis[4-(2-phenylethoxycarbonyloxy)butoxy]phosphoryl]carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 154433247 |
| Molecular Formula | C34H50N3O11P |
| Molecular Weight | 707.76 g/mol |
| Exact Mass | 707.32 |
| IUPAC Name | butyl 2-[[N'-[bis[4-(2-phenylethoxycarbonyloxy)butoxy]phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CCCCOC(=O)CN(C)C(N)=NP(=O)(OCCCCOC(=O)OCCc1ccccc1)OCCCCOC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C34H50N3O11P/c1-3-4-21-42-31(38)28-37(2)32(35)36-49(41,47-24-13-11-22-43-33(39)45-26-19-29-15-7-5-8-16-29)48-25-14-12-23-44-34(40)46-27-20-30-17-9-6-10-18-30/h5-10,15-18H,3-4,11-14,19-28H2,1-2H3,(H2,35,36,41) |
| InChIKey | WICVSHXDGGUDSC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|